CAS 669729-28-6 is the registry number for 5-(4-Isopropylphenyl)-4-methyl-4h-1,2,4-triazole-3-thiol, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 5g.
4-methyl-3-(4-propan-2-ylphenyl)-1H-1,2,4-triazole-5-thione (CAS 669729-28-6) is a chemical compound with the molecular formula C12H15N3S and a molecular weight of 233.33 g/mol. IUPAC name: 4-methyl-3-(4-propan-2-ylphenyl)-1H-1,2,4-triazole-5-thione. InChIKey: IDGXTEBIKJEDRP-UHFFFAOYSA-N.
| Molecular formula | C12H15N3S |
|---|---|
| Molecular weight | 233.33 g/mol |
| IUPAC name | 4-methyl-3-(4-propan-2-ylphenyl)-1H-1,2,4-triazole-5-thione |
| InChIKey | IDGXTEBIKJEDRP-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=C(C=C1)C2=NNC(=S)N2C |
Computed by PubChem (NCBI)