CAS 706811-25-8 appears in our catalog under these names: Macitentan Impurity 27, 5–(4–Bromophenyl)–6–hydroxypyrimidin–4(1H)–one, 5-(4-bromophenyl)pyrimidine-4,6 diol, 97%, 97%, 5-(4-Bromophenyl)-6-hydroxypyrimidin-4(1H)-one, 98%. Offered by: Chemat Brand, GLPBio, Chemat, Fluorochem. Available pack sizes: on request, 100g, 25g, 5g, 1g, 10g.
5-(4-bromophenyl)-4-hydroxy-1H-pyrimidin-6-one (CAS 706811-25-8) is a chemical compound with the molecular formula C10H7BrN2O2 and a molecular weight of 267.08 g/mol. IUPAC name: 5-(4-bromophenyl)-4-hydroxy-1H-pyrimidin-6-one. InChIKey: PIUMVXYVNAISNG-UHFFFAOYSA-N.
| Molecular formula | C10H7BrN2O2 |
|---|---|
| Molecular weight | 267.08 g/mol |
| IUPAC name | 5-(4-bromophenyl)-4-hydroxy-1H-pyrimidin-6-one |
| InChIKey | PIUMVXYVNAISNG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(N=CNC2=O)O)Br |
Computed by PubChem (NCBI)