CAS 138907-85-4 appears in our catalog under these names: 1-(4-bromophenyl)-1H-pyrazole-4-carboxylic acid, 1-(4-Bromophenyl)-1h-pyrazole-4-carboxylic acid, 95%, 1-(4-Bromophenyl)-1h-pyrazole-4-carboxylic acid, 98%, 98%, 1-(4-Bromo-phenyl)-1H-pyrazole-4-carboxylic acid, 98%. Offered by: Biosynth, Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 0,5g, 250mg, 100mg, 1g, 500mg.
1-(4-bromophenyl)pyrazole-4-carboxylic acid (CAS 138907-85-4) is a chemical compound with the molecular formula C10H7BrN2O2 and a molecular weight of 267.08 g/mol. IUPAC name: 1-(4-bromophenyl)pyrazole-4-carboxylic acid. InChIKey: GOJGAUFDFLULIK-UHFFFAOYSA-N.
| Molecular formula | C10H7BrN2O2 |
|---|---|
| Molecular weight | 267.08 g/mol |
| IUPAC name | 1-(4-bromophenyl)pyrazole-4-carboxylic acid |
| InChIKey | GOJGAUFDFLULIK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C=C(C=N2)C(=O)O)Br |
Computed by PubChem (NCBI)