Products 25217-77-0
CAS 25217-77-0 is the registry number for 5-Bromo-3-(2-nitrovinyl)indole, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
5-bromo-3-(2-nitroethenyl)-1H-indole (CAS 25217-77-0) is a chemical compound with the molecular formula C10H7BrN2O2 and a molecular weight of 267.08 g/mol. IUPAC name: 5-bromo-3-(2-nitroethenyl)-1H-indole. InChIKey: QZIAWMREHPRQEK-UHFFFAOYSA-N.
| Molecular formula | C10H7BrN2O2 |
|---|---|
| Molecular weight | 267.08 g/mol |
| IUPAC name | 5-bromo-3-(2-nitroethenyl)-1H-indole |
| InChIKey | QZIAWMREHPRQEK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Br)C(=CN2)C=C[N+](=O)[O-] |
Computed by PubChem (NCBI)