CAS 2143871-81-0 appears in our catalog under these names: 1-((3-Bromopyridin-4-yl)methyl)-1h-pyrrole-2,5-dione, 95%, 1–((3–Bromopyridin–4–yl)methyl)–1H–pyrrole–2,5–dione. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 1g, 100mg, 250mg, 5g.
1-[(3-bromo-4-pyridinyl)methyl]pyrrole-2,5-dione (CAS 2143871-81-0) is a chemical compound with the molecular formula C10H7BrN2O2 and a molecular weight of 267.08 g/mol. IUPAC name: 1-[(3-bromo-4-pyridinyl)methyl]pyrrole-2,5-dione. InChIKey: JQPAOARUSDRHJB-UHFFFAOYSA-N.
| Molecular formula | C10H7BrN2O2 |
|---|---|
| Molecular weight | 267.08 g/mol |
| IUPAC name | 1-[(3-bromo-4-pyridinyl)methyl]pyrrole-2,5-dione |
| InChIKey | JQPAOARUSDRHJB-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CC2=C(C=NC=C2)Br |
Computed by PubChem (NCBI)