cas: 27069-16-5 — see every product listed under this CAS number, including other names
5-(4-Methoxy-phenyl)-1H-pyrazole-3-carboxylic acid, 95% (CAS 27069-16-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F028078-100MG |
| cas | 27069-16-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 128.10 Pln | |
| Fluorochem | 250mg | 154.13 Pln | |
| Fluorochem | 1g | 221.81 Pln | |
| Fluorochem | 5g | 732.05 Pln | |
| Fluorochem | 10g | 1252.70 Pln | |
| Fluorochem | 25g | 3048.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
3-(4-methoxyphenyl)-1H-pyrazole-5-carboxylic acid (CAS 27069-16-5) is a chemical compound with the molecular formula C11H10N2O3 and a molecular weight of 218.21 g/mol. IUPAC name: 3-(4-methoxyphenyl)-1H-pyrazole-5-carboxylic acid. InChIKey: VHWPBROOEIJLIW-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O3 |
|---|---|
| Molecular weight | 218.21 g/mol |
| IUPAC name | 3-(4-methoxyphenyl)-1H-pyrazole-5-carboxylic acid |
| InChIKey | VHWPBROOEIJLIW-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NNC(=C2)C(=O)O |
Computed by PubChem (NCBI)