cas: 2034156-72-2 — see every product listed under this CAS number, including other names
5-(Aminomethyl)-1-(propan-2-yl)-1,2,3,4-tetrahydropyrimidine-2,4-dione hydrochloride, 95% (CAS 2034156-72-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A869184-10g |
| cas | 2034156-72-2 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 46870.39 Pln | |
| AmBeed | 1g | 11241.16 Pln | |
| AmBeed | 5g | 32652.55 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-(aminomethyl)-1-propan-2-ylpyrimidine-2,4-dione;hydrochloride (CAS 2034156-72-2) is a chemical compound with the molecular formula C8H14ClN3O2 and a molecular weight of 219.67 g/mol. IUPAC name: 5-(aminomethyl)-1-propan-2-ylpyrimidine-2,4-dione;hydrochloride. InChIKey: MQPPYKSCMWXPHC-UHFFFAOYSA-N.
| Molecular formula | C8H14ClN3O2 |
|---|---|
| Molecular weight | 219.67 g/mol |
| IUPAC name | 5-(aminomethyl)-1-propan-2-ylpyrimidine-2,4-dione;hydrochloride |
| InChIKey | MQPPYKSCMWXPHC-UHFFFAOYSA-N |
| SMILES | CC(C)N1C=C(C(=O)NC1=O)CN.Cl |
Computed by PubChem (NCBI)