CAS 1808784-71-5 is the registry number for ((2R,5S)-5-(3-Methyl-1,2,4-oxadiazol-5-yl)tetrahydrofuran-2-yl)methanamine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(2R,5S)-5-(3-methyl-1,2,4-oxadiazol-5-yl)oxolan-2-yl]methanamine;hydrochloride (CAS 1808784-71-5) is a chemical compound with the molecular formula C8H14ClN3O2 and a molecular weight of 219.67 g/mol. IUPAC name: [(2R,5S)-5-(3-methyl-1,2,4-oxadiazol-5-yl)oxolan-2-yl]methanamine;hydrochloride. InChIKey: JTASXULKLOOSGG-HHQFNNIRSA-N.
| Molecular formula | C8H14ClN3O2 |
|---|---|
| Molecular weight | 219.67 g/mol |
| IUPAC name | [(2R,5S)-5-(3-methyl-1,2,4-oxadiazol-5-yl)oxolan-2-yl]methanamine;hydrochloride |
| InChIKey | JTASXULKLOOSGG-HHQFNNIRSA-N |
| SMILES | CC1=NOC(=N1)[C@@H]2CC[C@@H](O2)CN.Cl |
Computed by PubChem (NCBI)