CAS 118384-75-1 appears in our catalog under these names: N–Me–His–OMe · HCl, N-Me-his-ome hydrochloride, 95%, N-Me-His-Ome HCl, 97%. Offered by: GLPBio, Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.
Methyl (2S)-3-(1H-imidazol-5-yl)-2-(methylamino)propanoate;hydrochloride (CAS 118384-75-1) is a chemical compound with the molecular formula C8H14ClN3O2 and a molecular weight of 219.67 g/mol. IUPAC name: methyl (2S)-3-(1H-imidazol-5-yl)-2-(methylamino)propanoate;hydrochloride. InChIKey: WMEMVRNBUHETIW-FJXQXJEOSA-N.
| Molecular formula | C8H14ClN3O2 |
|---|---|
| Molecular weight | 219.67 g/mol |
| IUPAC name | methyl (2S)-3-(1H-imidazol-5-yl)-2-(methylamino)propanoate;hydrochloride |
| InChIKey | WMEMVRNBUHETIW-FJXQXJEOSA-N |
| SMILES | CN[C@@H](CC1=CN=CN1)C(=O)OC.Cl |
Computed by PubChem (NCBI)