CAS 1417567-78-2 is the registry number for Ethyl 2-(4-amino-1H-pyrazol-1-yl)propanoate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 10g, 1g.
Ethyl 2-(4-aminopyrazol-1-yl)propanoate;hydrochloride (CAS 1417567-78-2) is a chemical compound with the molecular formula C8H14ClN3O2 and a molecular weight of 219.67 g/mol. IUPAC name: ethyl 2-(4-aminopyrazol-1-yl)propanoate;hydrochloride. InChIKey: DUUWWIRMESEUHX-UHFFFAOYSA-N.
| Molecular formula | C8H14ClN3O2 |
|---|---|
| Molecular weight | 219.67 g/mol |
| IUPAC name | ethyl 2-(4-aminopyrazol-1-yl)propanoate;hydrochloride |
| InChIKey | DUUWWIRMESEUHX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)N1C=C(C=N1)N.Cl |
Computed by PubChem (NCBI)