cas: 66644-80-2 — see every product listed under this CAS number, including other names
5-(Aminosulfonyl)-2,3-dimethoxybenzoic Acid, >98.0%(HPLC)(T) (CAS 66644-80-2) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | A2126-5G |
| cas | 66644-80-2 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 152.77 Pln | |
| TCI | 25g | 447.80 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(T) |
2,3-dimethoxy-5-sulfamoylbenzoic acid (CAS 66644-80-2) is a chemical compound with the molecular formula C9H11NO6S and a molecular weight of 261.25 g/mol. IUPAC name: 2,3-dimethoxy-5-sulfamoylbenzoic acid. InChIKey: YEVQOPOKMKTXMD-UHFFFAOYSA-N.
| Molecular formula | C9H11NO6S |
|---|---|
| Molecular weight | 261.25 g/mol |
| IUPAC name | 2,3-dimethoxy-5-sulfamoylbenzoic acid |
| InChIKey | YEVQOPOKMKTXMD-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1OC)C(=O)O)S(=O)(=O)N |
Computed by PubChem (NCBI)