Products 874841-12-0

CAS 874841-12-0 appears in our catalog under these names: 2,6-Dimethoxy-3-sulfamoylbenzoic acid, 95%, 2,6-Dimethoxy-3-sulfamoylbenzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.

2,6-dimethoxy-3-sulfamoylbenzoic acid (CAS 874841-12-0) is a chemical compound with the molecular formula C9H11NO6S and a molecular weight of 261.25 g/mol. IUPAC name: 2,6-dimethoxy-3-sulfamoylbenzoic acid. InChIKey: CORYOSUAETTXGO-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11NO6S
Molecular weight261.25 g/mol
IUPAC name2,6-dimethoxy-3-sulfamoylbenzoic acid
InChIKeyCORYOSUAETTXGO-UHFFFAOYSA-N
SMILESCOC1=C(C(=C(C=C1)S(=O)(=O)N)OC)C(=O)O

Computed by PubChem (NCBI)