CAS 66644-80-2 appears in our catalog under these names: 2,3-Dimethoxy-5-sulfamoylbenzoic acid, 98%, 5–(Aminosulfonyl)–2,3–dimethoxybenzoic Acid, 5-(Aminosulfonyl)-2,3-dimethoxybenzoic Acid, >98.0%(HPLC)(T), 2,3-Dimethoxy-5-sulfamoylbenzoic acid, ≥98%, ≥98%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 25g, 500g, 5g, 1g, 100g.
2,3-dimethoxy-5-sulfamoylbenzoic acid (CAS 66644-80-2) is a chemical compound with the molecular formula C9H11NO6S and a molecular weight of 261.25 g/mol. IUPAC name: 2,3-dimethoxy-5-sulfamoylbenzoic acid. InChIKey: YEVQOPOKMKTXMD-UHFFFAOYSA-N.
| Molecular formula | C9H11NO6S |
|---|---|
| Molecular weight | 261.25 g/mol |
| IUPAC name | 2,3-dimethoxy-5-sulfamoylbenzoic acid |
| InChIKey | YEVQOPOKMKTXMD-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1OC)C(=O)O)S(=O)(=O)N |
Computed by PubChem (NCBI)