Products 66644-80-2

CAS 66644-80-2 appears in our catalog under these names: 2,3-Dimethoxy-5-sulfamoylbenzoic acid, 98%, 5–(Aminosulfonyl)–2,3–dimethoxybenzoic Acid, 5-(Aminosulfonyl)-2,3-dimethoxybenzoic Acid, >98.0%(HPLC)(T), 2,3-Dimethoxy-5-sulfamoylbenzoic acid, ≥98%, ≥98%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 25g, 500g, 5g, 1g, 100g.

Structural formula: {0} (CAS {1})

2,3-dimethoxy-5-sulfamoylbenzoic acid (CAS 66644-80-2) is a chemical compound with the molecular formula C9H11NO6S and a molecular weight of 261.25 g/mol. IUPAC name: 2,3-dimethoxy-5-sulfamoylbenzoic acid. InChIKey: YEVQOPOKMKTXMD-UHFFFAOYSA-N.

Identity
Molecular formulaC9H11NO6S
Molecular weight261.25 g/mol
IUPAC name2,3-dimethoxy-5-sulfamoylbenzoic acid
InChIKeyYEVQOPOKMKTXMD-UHFFFAOYSA-N
SMILESCOC1=CC(=CC(=C1OC)C(=O)O)S(=O)(=O)N

Computed by PubChem (NCBI)