CAS 361374-13-2 appears in our catalog under these names: 5-(Morpholin-4-ylsulfonyl)-2-furoic acid, 95%, 5-(Morpholine-4-sulfonyl)furan-2-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 10g, 5g, 250mg, 100mg.
5-morpholin-4-ylsulfonylfuran-2-carboxylic acid (CAS 361374-13-2) is a chemical compound with the molecular formula C9H11NO6S and a molecular weight of 261.25 g/mol. IUPAC name: 5-morpholin-4-ylsulfonylfuran-2-carboxylic acid. InChIKey: KUFFIEBVYHIWTO-UHFFFAOYSA-N.
| Molecular formula | C9H11NO6S |
|---|---|
| Molecular weight | 261.25 g/mol |
| IUPAC name | 5-morpholin-4-ylsulfonylfuran-2-carboxylic acid |
| InChIKey | KUFFIEBVYHIWTO-UHFFFAOYSA-N |
| SMILES | C1COCCN1S(=O)(=O)C2=CC=C(O2)C(=O)O |
Computed by PubChem (NCBI)