cas: 107550-30-1 — see every product listed under this CAS number, including other names
5-(Benzyloxy)-4-oxo-1,4-dihydropyridine-2-carboxylic acid, 96%, 96% (CAS 107550-30-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11041P-100mg |
| cas | 107550-30-1 |
| size | 100mg |
| availability | 9g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 275.60 Pln | |
| Chemat | 250mg | 443.60 Pln | |
| Chemat | 1g | 1082.00 Pln | |
| Chemat | 5g | 2776.40 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
4-oxo-5-phenylmethoxy-1H-pyridine-2-carboxylic acid (CAS 107550-30-1) is a chemical compound with the molecular formula C13H11NO4 and a molecular weight of 245.23 g/mol. IUPAC name: 4-oxo-5-phenylmethoxy-1H-pyridine-2-carboxylic acid. InChIKey: TUJMNQZMSQDVAR-UHFFFAOYSA-N.
| Molecular formula | C13H11NO4 |
|---|---|
| Molecular weight | 245.23 g/mol |
| IUPAC name | 4-oxo-5-phenylmethoxy-1H-pyridine-2-carboxylic acid |
| InChIKey | TUJMNQZMSQDVAR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CNC(=CC2=O)C(=O)O |
Computed by PubChem (NCBI)