cas: 1174321-06-2 — see every product listed under this CAS number, including other names
5-(Difluoromethyl)pyrazine-2-carboxylic acid 95% (CAS 1174321-06-2) is a chemical reagent available from Chemat. Available pack sizes: 25g, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A402156-25g |
| cas | 1174321-06-2 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25g | 3557.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 359.25 Pln | |
| Ambeed | 5g | 1071.25 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A402156 |
5-(difluoromethyl)pyrazine-2-carboxylic acid (CAS 1174321-06-2) is a chemical compound with the molecular formula C6H4F2N2O2 and a molecular weight of 174.10 g/mol. IUPAC name: 5-(difluoromethyl)pyrazine-2-carboxylic acid. InChIKey: UYWJPTNAOQSWOS-UHFFFAOYSA-N.
| Molecular formula | C6H4F2N2O2 |
|---|---|
| Molecular weight | 174.10 g/mol |
| IUPAC name | 5-(difluoromethyl)pyrazine-2-carboxylic acid |
| InChIKey | UYWJPTNAOQSWOS-UHFFFAOYSA-N |
| SMILES | C1=C(N=CC(=N1)C(=O)O)C(F)F |
Computed by PubChem (NCBI)