cas: 874219-60-0 — see every product listed under this CAS number, including other names
5-(Ethoxycarbonyl)-2-fluorophenylboronic Acid (contains varying amounts of Anhydride) (CAS 874219-60-0) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 1g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | E1209-200MG |
| cas | 874219-60-0 |
| size | 200mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 200mg | 172.43 Pln | |
| TCI | 1g | 516.64 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | 0 |
(5-ethoxycarbonyl-2-fluorophenyl)boronic acid (CAS 874219-60-0) is a chemical compound with the molecular formula C9H10BFO4 and a molecular weight of 211.98 g/mol. IUPAC name: (5-ethoxycarbonyl-2-fluorophenyl)boronic acid. InChIKey: QXIIYFKTSGJTNE-UHFFFAOYSA-N.
| Molecular formula | C9H10BFO4 |
|---|---|
| Molecular weight | 211.98 g/mol |
| IUPAC name | (5-ethoxycarbonyl-2-fluorophenyl)boronic acid |
| InChIKey | QXIIYFKTSGJTNE-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C(=O)OCC)F)(O)O |
Computed by PubChem (NCBI)