cas: 32933-01-0 — see every product listed under this CAS number, including other names
5-(Ethoxycarbonyl)furan-2-carboxylic acid 95% (CAS 32933-01-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A575486-100mg |
| cas | 32933-01-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 314.75 Pln | |
| Ambeed | 250mg | 481.62 Pln | |
| Ambeed | 1g | 1210.31 Pln | |
| Ambeed | 5g | 3524.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A575486 |
5-ethoxycarbonylfuran-2-carboxylic acid (CAS 32933-01-0) is a chemical compound with the molecular formula C8H8O5 and a molecular weight of 184.15 g/mol. IUPAC name: 5-ethoxycarbonylfuran-2-carboxylic acid. InChIKey: SMMNUDQGZVFDTO-UHFFFAOYSA-N.
| Molecular formula | C8H8O5 |
|---|---|
| Molecular weight | 184.15 g/mol |
| IUPAC name | 5-ethoxycarbonylfuran-2-carboxylic acid |
| InChIKey | SMMNUDQGZVFDTO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(O1)C(=O)O |
Computed by PubChem (NCBI)