CAS 32933-01-0 appears in our catalog under these names: 5-(Ethoxycarbonyl)furan-2-carboxylic acid, 95%, 5-(Ethoxycarbonyl)furan-2-carboxylic acid, 5-(Ethoxycarbonyl)furan-2-carboxylic acid 95%, 5-(ethoxycarbonyl)furan-2-carboxylic acid, 97%, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 0,5g, 100mg, 10g.
5-ethoxycarbonylfuran-2-carboxylic acid (CAS 32933-01-0) is a chemical compound with the molecular formula C8H8O5 and a molecular weight of 184.15 g/mol. IUPAC name: 5-ethoxycarbonylfuran-2-carboxylic acid. InChIKey: SMMNUDQGZVFDTO-UHFFFAOYSA-N.
| Molecular formula | C8H8O5 |
|---|---|
| Molecular weight | 184.15 g/mol |
| IUPAC name | 5-ethoxycarbonylfuran-2-carboxylic acid |
| InChIKey | SMMNUDQGZVFDTO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(O1)C(=O)O |
Computed by PubChem (NCBI)