CAS 55313-03-6 is the registry number for 2-Hydroxy-1-(2,4,6-trihydroxyphenyl)ethanone, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-hydroxy-1-(2,4,6-trihydroxyphenyl)ethanone (CAS 55313-03-6) is a chemical compound with the molecular formula C8H8O5 and a molecular weight of 184.15 g/mol. IUPAC name: 2-hydroxy-1-(2,4,6-trihydroxyphenyl)ethanone. InChIKey: HPPCGHJRDOZHQY-UHFFFAOYSA-N.
| Molecular formula | C8H8O5 |
|---|---|
| Molecular weight | 184.15 g/mol |
| IUPAC name | 2-hydroxy-1-(2,4,6-trihydroxyphenyl)ethanone |
| InChIKey | HPPCGHJRDOZHQY-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1O)C(=O)CO)O)O |
Computed by PubChem (NCBI)