cas: 32933-01-0 — see every product listed under this CAS number, including other names
5-(ethoxycarbonyl)furan-2-carboxylic acid, 97%, 97% (CAS 32933-01-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11CN2O-1g |
| cas | 32933-01-0 |
| size | 1g |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1619.60 Pln | |
| Chemat | 5g | 5651.60 Pln | |
| Chemat | 10g | 9290.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
5-ethoxycarbonylfuran-2-carboxylic acid (CAS 32933-01-0) is a chemical compound with the molecular formula C8H8O5 and a molecular weight of 184.15 g/mol. IUPAC name: 5-ethoxycarbonylfuran-2-carboxylic acid. InChIKey: SMMNUDQGZVFDTO-UHFFFAOYSA-N.
| Molecular formula | C8H8O5 |
|---|---|
| Molecular weight | 184.15 g/mol |
| IUPAC name | 5-ethoxycarbonylfuran-2-carboxylic acid |
| InChIKey | SMMNUDQGZVFDTO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(O1)C(=O)O |
Computed by PubChem (NCBI)