5-(Ethoxymethylene)-2,2-dimethyl-1,3-dioxane-4,6-dione, 95%
cas: 15568-86-2 — see every product listed under this CAS number, including other names
5-(Ethoxymethylene)-2,2-dimethyl-1,3-dioxane-4,6-dione, 95% (CAS 15568-86-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A379666-250mg |
| cas | 15568-86-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 159.00 Pln | |
| Ambeed | 1g | 309.19 Pln | |
| Ambeed | 5g | 865.44 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 213.20 Pln | |
| Chemat | 5g | 554.00 Pln | |
| BLDpharm | 250mg | 186.63 Pln | |
| BLDpharm | 1g | 292.14 Pln | |
| BLDpharm | 5g | 803.08 Pln | |
| BLDpharm | 10g | 1158.51 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
5-(ethoxymethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione (CAS 15568-86-2) is a chemical compound with the molecular formula C9H12O5 and a molecular weight of 200.19 g/mol. IUPAC name: 5-(ethoxymethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione. InChIKey: VRWNGTZFEHJVFT-UHFFFAOYSA-N.
| Molecular formula | C9H12O5 |
|---|---|
| Molecular weight | 200.19 g/mol |
| IUPAC name | 5-(ethoxymethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione |
| InChIKey | VRWNGTZFEHJVFT-UHFFFAOYSA-N |
| SMILES | CCOC=C1C(=O)OC(OC1=O)(C)C |
Computed by PubChem (NCBI)
Synonyms:
5-(ethoxymethylene)-2,2-dimethyl-1,3-dioxane-4,6-dione, 5-(ethoxymethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione, 1,3-Dioxane-4,6-dione, 5-(ethoxymethylene)-2,2-dimethyl-, VRWNGTZFEHJVFT-UHFFFAOYSA-N, 5-ethoxymethylene-2,2-dimethyl-[1,3]dioxane-4,6-dione, 2,2-dimethyl-5-ethoxymethylene-1,3-dioxane-4,6-dione, 5-ethoxymethylene-2,2-dimethyl-4,6-dioxo-1,3-dioxane, InChI=1/C9H12O5/c1-4-12-5-6-7(10)13-9(2,3)14-8(6)11/h5H,4H2,1-3H