CAS 28269-03-6 appears in our catalog under these names: 4-Oxo-cyclopentane-trans-1,2-dicarboxylic acid dimethyl ester, 98%, (1R,2R)-rel-Dimethyl 4-oxocyclopentane-1,2-dicarboxylate, 97%, (1R,2R)–rel–Dimethyl 4–oxocyclopentane–1,2–dicarboxylate, (1R,2R)-rel-Dimethyl 4-oxocyclopentane-1,2-dicarboxylate 97%, (1R,2R)-rel-Dimethyl 4-oxocyclopentane-1,2-dicarboxylate, 97%, 97%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 25g, 100g, 1g, 5g, 10g, 100mg, 250mg, 50g.
Trans-dimethyl (1R,2R)-4-oxocyclopentane-1,2-dicarboxylate (CAS 28269-03-6) is a chemical compound with the molecular formula C9H12O5 and a molecular weight of 200.19 g/mol. IUPAC name: trans-dimethyl (1R,2R)-4-oxocyclopentane-1,2-dicarboxylate. InChIKey: GMKJWKXCHOWVDN-RNFRBKRXSA-N.
| Molecular formula | C9H12O5 |
|---|---|
| Molecular weight | 200.19 g/mol |
| IUPAC name | trans-dimethyl (1R,2R)-4-oxocyclopentane-1,2-dicarboxylate |
| InChIKey | GMKJWKXCHOWVDN-RNFRBKRXSA-N |
| SMILES | COC(=O)[C@@H]1CC(=O)C[C@H]1C(=O)OC |
Computed by PubChem (NCBI)