CAS 28269-02-5 appears in our catalog under these names: 4-Oxo-cyclopentane-cis-1,2-dicarboxylic acid dimethyl ester, 95%, cis-Dimethyl 4-oxocyclopentane-1,2-dicarboxylate, 97%, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 5g, 100mg, 250mg.
Cis-dimethyl (1S,2R)-4-oxocyclopentane-1,2-dicarboxylate (CAS 28269-02-5) is a chemical compound with the molecular formula C9H12O5 and a molecular weight of 200.19 g/mol. IUPAC name: cis-dimethyl (1S,2R)-4-oxocyclopentane-1,2-dicarboxylate. InChIKey: GMKJWKXCHOWVDN-KNVOCYPGSA-N.
| Molecular formula | C9H12O5 |
|---|---|
| Molecular weight | 200.19 g/mol |
| IUPAC name | cis-dimethyl (1S,2R)-4-oxocyclopentane-1,2-dicarboxylate |
| InChIKey | GMKJWKXCHOWVDN-KNVOCYPGSA-N |
| SMILES | COC(=O)[C@@H]1CC(=O)C[C@@H]1C(=O)OC |
Computed by PubChem (NCBI)