Products 112026-00-3
CAS 112026-00-3 is the registry number for 2-Ethyl-2,5-dihydro-4-hydroxy-3-methyl-5-oxo-2-furancarboxylic Acid Methyl Ester. Offered by: TRC. Available pack sizes: 100mg, 250mg, 500mg.
Methyl 2-ethyl-4-hydroxy-3-methyl-5-oxofuran-2-carboxylate (CAS 112026-00-3) is a chemical compound with the molecular formula C9H12O5 and a molecular weight of 200.19 g/mol. IUPAC name: methyl 2-ethyl-4-hydroxy-3-methyl-5-oxofuran-2-carboxylate. InChIKey: RLIICWPUGZALKD-UHFFFAOYSA-N.
| Molecular formula | C9H12O5 |
|---|---|
| Molecular weight | 200.19 g/mol |
| IUPAC name | methyl 2-ethyl-4-hydroxy-3-methyl-5-oxofuran-2-carboxylate |
| InChIKey | RLIICWPUGZALKD-UHFFFAOYSA-N |
| SMILES | CCC1(C(=C(C(=O)O1)O)C)C(=O)OC |
Computed by PubChem (NCBI)