cas: 1268816-48-3 — see every product listed under this CAS number, including other names
5-(Methylsulfonyl)-1H-indazole, 95+%, 95+% (CAS 1268816-48-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111TF0-100mg |
| cas | 1268816-48-3 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 299.60 Pln | |
| Chemat | 250mg | 467.60 Pln | |
| Chemat | 1g | 1245.20 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
5-methylsulfonyl-1H-indazole (CAS 1268816-48-3) is a chemical compound with the molecular formula C8H8N2O2S and a molecular weight of 196.23 g/mol. IUPAC name: 5-methylsulfonyl-1H-indazole. InChIKey: VLCCXHFNVCNWPU-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O2S |
|---|---|
| Molecular weight | 196.23 g/mol |
| IUPAC name | 5-methylsulfonyl-1H-indazole |
| InChIKey | VLCCXHFNVCNWPU-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC2=C(C=C1)NN=C2 |
Computed by PubChem (NCBI)