CAS 1874188-36-9 is the registry number for 5-(Piperidin-2-yl)-1,3-oxazole-4-carboxylic acid, 95%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g.
5-piperidin-2-yl-1,3-oxazole-4-carboxylic acid (CAS 1874188-36-9) is a chemical compound with the molecular formula C9H12N2O3 and a molecular weight of 196.20 g/mol. IUPAC name: 5-piperidin-2-yl-1,3-oxazole-4-carboxylic acid. InChIKey: QIZGODMHDYCVQK-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O3 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | 5-piperidin-2-yl-1,3-oxazole-4-carboxylic acid |
| InChIKey | QIZGODMHDYCVQK-UHFFFAOYSA-N |
| SMILES | C1CCNC(C1)C2=C(N=CO2)C(=O)O |
Computed by PubChem (NCBI)