cas: 119082-97-2 — see every product listed under this CAS number, including other names
5-(Pyridin-2-yl)thiophene-2-carboxylic acid 95+% (CAS 119082-97-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A347771-250mg |
| cas | 119082-97-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 225.75 Pln | |
| Ambeed | 1g | 398.19 Pln | |
| Ambeed | 5g | 1538.50 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A347771 |
5-pyridin-2-ylthiophene-2-carboxylic acid (CAS 119082-97-2) is a chemical compound with the molecular formula C10H7NO2S and a molecular weight of 205.23 g/mol. IUPAC name: 5-pyridin-2-ylthiophene-2-carboxylic acid. InChIKey: HQULGJDHOPDURG-UHFFFAOYSA-N.
| Molecular formula | C10H7NO2S |
|---|---|
| Molecular weight | 205.23 g/mol |
| IUPAC name | 5-pyridin-2-ylthiophene-2-carboxylic acid |
| InChIKey | HQULGJDHOPDURG-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC=C(S2)C(=O)O |
Computed by PubChem (NCBI)