CAS 10058-38-5 appears in our catalog under these names: 2-Phenylthiazole-5-carboxylic acid 97%, 2-Phenylthiazole-5-carboxylic acid, 95%, 95%, 2-Phenyl-thiazole-5-carboxylic acid, 95%, 2-phenyl-1,3-thiazole-5-carboxylic acid, 98%. Offered by: Ambeed, Chemat, Fluorochem, Combi-blocks. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
2-phenyl-1,3-thiazole-5-carboxylic acid (CAS 10058-38-5) is a chemical compound with the molecular formula C10H7NO2S and a molecular weight of 205.23 g/mol. IUPAC name: 2-phenyl-1,3-thiazole-5-carboxylic acid. InChIKey: LCALUFNLWHYTKX-UHFFFAOYSA-N.
| Molecular formula | C10H7NO2S |
|---|---|
| Molecular weight | 205.23 g/mol |
| IUPAC name | 2-phenyl-1,3-thiazole-5-carboxylic acid |
| InChIKey | LCALUFNLWHYTKX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC=C(S2)C(=O)O |
Computed by PubChem (NCBI)