cas: 119082-97-2 — see every product listed under this CAS number, including other names
5-Pyrid-2-ylthiophene-2-carboxylic acid, 95% (CAS 119082-97-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F017511-250MG |
| cas | 119082-97-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 185.37 Pln | |
| Fluorochem | 1g | 1507.82 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 95% |
5-pyridin-2-ylthiophene-2-carboxylic acid (CAS 119082-97-2) is a chemical compound with the molecular formula C10H7NO2S and a molecular weight of 205.23 g/mol. IUPAC name: 5-pyridin-2-ylthiophene-2-carboxylic acid. InChIKey: HQULGJDHOPDURG-UHFFFAOYSA-N.
| Molecular formula | C10H7NO2S |
|---|---|
| Molecular weight | 205.23 g/mol |
| IUPAC name | 5-pyridin-2-ylthiophene-2-carboxylic acid |
| InChIKey | HQULGJDHOPDURG-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC=C(S2)C(=O)O |
Computed by PubChem (NCBI)