Products 119082-97-2
CAS 119082-97-2 appears in our catalog under these names: 5-(2-Pyridyl)thiophene-2-carboxylic acid, 5-Pyrid-2-ylthiophene-2-carboxylic acid, 95%, 5-(Pyridin-2-yl)thiophene-2-carboxylic acid, 95%, 5-(Pyridin-2-yl)thiophene-2-carboxylic acid 95+%, 5-(Pyridin-2-yl)thiophene-2-carboxylic acid, 95+%, 95+%. Offered by: Biosynth, Fluorochem, Combi-blocks, Ambeed, Chemat. Available pack sizes: 5g, 250mg, 1g, 10g.
5-pyridin-2-ylthiophene-2-carboxylic acid (CAS 119082-97-2) is a chemical compound with the molecular formula C10H7NO2S and a molecular weight of 205.23 g/mol. IUPAC name: 5-pyridin-2-ylthiophene-2-carboxylic acid. InChIKey: HQULGJDHOPDURG-UHFFFAOYSA-N.
| Molecular formula | C10H7NO2S |
|---|---|
| Molecular weight | 205.23 g/mol |
| IUPAC name | 5-pyridin-2-ylthiophene-2-carboxylic acid |
| InChIKey | HQULGJDHOPDURG-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC=C(S2)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
5-(pyridin-2-yl)thiophene-2-carboxylic acid, 5-(2-pyridyl)thiophene-2-carboxylic acid, 5-pyridin-2-ylthiophene-2-carboxylic acid, 2-Thiophenecarboxylic acid, 5-(2-pyridinyl)-, 5-Pyridin-2-yl-thiophene-2-carboxylic acid, 2-Thiophenecarboxylic acid, 5-(pyridinyl)-, 5-pyrid-2-ylthiophene-2-carboxylic acid, Maybridge1_002323, DivK1c_001075, orb3031004