cas: 25825-31-4 — see every product listed under this CAS number, including other names
5-(TERT-BUTYL)-3-(MORPHOLINOMETHYL)BENZENE-1,2-DIOL (CAS 25825-31-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F538677-250MG |
| cas | 25825-31-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1841.04 Pln | |
| Fluorochem | 1g | 4418.25 Pln | |
| Fluorochem | 5g | 13040.22 Pln |
| delivery time | 3-4 weeks |
|---|
5-tert-butyl-3-(morpholin-4-ylmethyl)benzene-1,2-diol (CAS 25825-31-4) is a chemical compound with the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. IUPAC name: 5-tert-butyl-3-(morpholin-4-ylmethyl)benzene-1,2-diol. InChIKey: MUHOBORMCCTQOM-UHFFFAOYSA-N.
| Molecular formula | C15H23NO3 |
|---|---|
| Molecular weight | 265.35 g/mol |
| IUPAC name | 5-tert-butyl-3-(morpholin-4-ylmethyl)benzene-1,2-diol |
| InChIKey | MUHOBORMCCTQOM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C(=C1)O)O)CN2CCOCC2 |
Computed by PubChem (NCBI)