cas: 25825-31-4 — see every product listed under this CAS number, including other names
5-(tert-butyl)-3-(morpholinomethyl)benzene-1,2-diol, 99%, 99% (CAS 25825-31-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12JWP1-250mg |
| cas | 25825-31-4 |
| size | 250mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 1125.20 Pln | |
| Chemat | 1g | 2685.20 Pln | |
| Chemat | 5g | 7888.40 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
5-tert-butyl-3-(morpholin-4-ylmethyl)benzene-1,2-diol (CAS 25825-31-4) is a chemical compound with the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. IUPAC name: 5-tert-butyl-3-(morpholin-4-ylmethyl)benzene-1,2-diol. InChIKey: MUHOBORMCCTQOM-UHFFFAOYSA-N.
| Molecular formula | C15H23NO3 |
|---|---|
| Molecular weight | 265.35 g/mol |
| IUPAC name | 5-tert-butyl-3-(morpholin-4-ylmethyl)benzene-1,2-diol |
| InChIKey | MUHOBORMCCTQOM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C(=C1)O)O)CN2CCOCC2 |
Computed by PubChem (NCBI)