cas: 105391-76-2 — see every product listed under this CAS number, including other names
5-(Trifluoromethoxy)-1H-indazole 97% (CAS 105391-76-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A566119-100mg |
| cas | 105391-76-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 181.25 Pln | |
| Ambeed | 250mg | 209.06 Pln | |
| Ambeed | 1g | 448.25 Pln | |
| Ambeed | 5g | 1577.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A566119 |
5-(trifluoromethoxy)-1H-indazole (CAS 105391-76-2) is a chemical compound with the molecular formula C8H5F3N2O and a molecular weight of 202.13 g/mol. IUPAC name: 5-(trifluoromethoxy)-1H-indazole. InChIKey: UTJHKIRGHNBXRL-UHFFFAOYSA-N.
| Molecular formula | C8H5F3N2O |
|---|---|
| Molecular weight | 202.13 g/mol |
| IUPAC name | 5-(trifluoromethoxy)-1H-indazole |
| InChIKey | UTJHKIRGHNBXRL-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1OC(F)(F)F)C=NN2 |
Computed by PubChem (NCBI)