Products 67370-98-3

CAS 67370-98-3 is the registry number for Acotiamide Impurity 26. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2,4-dihydroxy-5-methoxybenzoic acid (CAS 67370-98-3) is a chemical compound with the molecular formula C8H8O5 and a molecular weight of 184.15 g/mol. IUPAC name: 2,4-dihydroxy-5-methoxybenzoic acid. InChIKey: UWCZIWYPSUEYEI-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8O5
Molecular weight184.15 g/mol
IUPAC name2,4-dihydroxy-5-methoxybenzoic acid
InChIKeyUWCZIWYPSUEYEI-UHFFFAOYSA-N
SMILESCOC1=C(C=C(C(=C1)C(=O)O)O)O

Computed by PubChem (NCBI)