CAS 67370-98-3 is the registry number for Acotiamide Impurity 26. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dihydroxy-5-methoxybenzoic acid (CAS 67370-98-3) is a chemical compound with the molecular formula C8H8O5 and a molecular weight of 184.15 g/mol. IUPAC name: 2,4-dihydroxy-5-methoxybenzoic acid. InChIKey: UWCZIWYPSUEYEI-UHFFFAOYSA-N.
| Molecular formula | C8H8O5 |
|---|---|
| Molecular weight | 184.15 g/mol |
| IUPAC name | 2,4-dihydroxy-5-methoxybenzoic acid |
| InChIKey | UWCZIWYPSUEYEI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C(=O)O)O)O |
Computed by PubChem (NCBI)