Products 1270311-68-6

CAS 1270311-68-6 is the registry number for 5-(m-Tolyl)pyrrolidine-2-carboxylic acid, 95%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 50mg, 1g.

Structural formula: {0} (CAS {1})

5-(3-methylphenyl)pyrrolidine-2-carboxylic acid (CAS 1270311-68-6) is a chemical compound with the molecular formula C12H15NO2 and a molecular weight of 205.25 g/mol. IUPAC name: 5-(3-methylphenyl)pyrrolidine-2-carboxylic acid. InChIKey: NIULYQYXAZPHKN-UHFFFAOYSA-N.

Identity
Molecular formulaC12H15NO2
Molecular weight205.25 g/mol
IUPAC name5-(3-methylphenyl)pyrrolidine-2-carboxylic acid
InChIKeyNIULYQYXAZPHKN-UHFFFAOYSA-N
SMILESCC1=CC(=CC=C1)C2CCC(N2)C(=O)O

Computed by PubChem (NCBI)