cas: 99347-08-7 — see every product listed under this CAS number, including other names
5-Amino-1-methyl-1,5-dihydro-4H-pyrazolo(3,4-d)pyrimidin-4-one, 95% (CAS 99347-08-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1087436-5g |
| cas | 99347-08-7 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 6417.25 Pln | |
| AmBeed | 10g | 10225.60 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-amino-1-methylpyrazolo[5,4-d]pyrimidin-4-one (CAS 99347-08-7) is a chemical compound with the molecular formula C6H7N5O and a molecular weight of 165.15 g/mol. IUPAC name: 5-amino-1-methylpyrazolo[5,4-d]pyrimidin-4-one. InChIKey: TVKDNILWGVYQAU-UHFFFAOYSA-N.
| Molecular formula | C6H7N5O |
|---|---|
| Molecular weight | 165.15 g/mol |
| IUPAC name | 5-amino-1-methylpyrazolo[5,4-d]pyrimidin-4-one |
| InChIKey | TVKDNILWGVYQAU-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=N1)C(=O)N(C=N2)N |
Computed by PubChem (NCBI)