5-Amino-2,3-difluorobenzoic acid, 95%
cas: 874838-32-1 — see every product listed under this CAS number, including other names
5-Amino-2,3-difluorobenzoic acid, 95% (CAS 874838-32-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 25g, 10g, 5g, 1g, 100mg. Offered by: Combi-blocks, Fluorochem, Ambeed, BLDpharm.
| brand | Combi-blocks |
|---|---|
| catalog number | HA-5376-250mg |
| cas | 874838-32-1 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 10g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 1g | price on request | |
| Fluorochem | 100mg | 570.65 Pln | |
| Ambeed | 100mg | 381.50 Pln | |
| Ambeed | 250mg | 637.38 Pln | |
| Ambeed | 1g | 1577.44 Pln | |
| Ambeed | 5g | 5348.81 Pln | |
| BLDpharm | 100mg | 408.77 Pln | |
| BLDpharm | 250mg | 680.90 Pln | |
| BLDpharm | 1g | 1697.20 Pln | |
| BLDpharm | 5g | 5762.44 Pln | |
| Chemat | 100mg | 309.20 Pln | |
| Chemat | 250mg | 510.80 Pln | |
| Chemat | 1g | 1269.20 Pln | |
| Chemat | 5g | 4293.20 Pln | |
| Fluorochem | 250mg | 643.54 Pln | |
| Fluorochem | 1g | 1622.36 Pln | |
| Fluorochem | 5g | 5464.76 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
5-amino-2,3-difluorobenzoic acid (CAS 874838-32-1) is a chemical compound with the molecular formula C7H5F2NO2 and a molecular weight of 173.12 g/mol. IUPAC name: 5-amino-2,3-difluorobenzoic acid. InChIKey: YQXQZKKJAITNKW-UHFFFAOYSA-N.
| Molecular formula | C7H5F2NO2 |
|---|---|
| Molecular weight | 173.12 g/mol |
| IUPAC name | 5-amino-2,3-difluorobenzoic acid |
| InChIKey | YQXQZKKJAITNKW-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)O)F)F)N |
Computed by PubChem (NCBI)