cas: 952917-89-4 — see every product listed under this CAS number, including other names
5-Amino-2-(benzylamino)benzonitrile, 95%, 95% (CAS 952917-89-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IIX2-100mg |
| cas | 952917-89-4 |
| size | 100mg |
| availability | 0.45g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 2128.40 Pln | |
| Chemat | 250mg | 3851.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5-amino-2-(benzylamino)benzonitrile (CAS 952917-89-4) is a chemical compound with the molecular formula C14H13N3 and a molecular weight of 223.27 g/mol. IUPAC name: 5-amino-2-(benzylamino)benzonitrile. InChIKey: CVXDKWLZMPOXSV-UHFFFAOYSA-N.
| Molecular formula | C14H13N3 |
|---|---|
| Molecular weight | 223.27 g/mol |
| IUPAC name | 5-amino-2-(benzylamino)benzonitrile |
| InChIKey | CVXDKWLZMPOXSV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=C(C=C(C=C2)N)C#N |
Computed by PubChem (NCBI)