cas: 328028-10-0 — see every product listed under this CAS number, including other names
5-Amino-2-chloro-N-(4-chlorophenyl)benzene-1-sulfonamide, 95% (CAS 328028-10-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F641863-100MG |
| cas | 328028-10-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 388.42 Pln | |
| Fluorochem | 250mg | 529.00 Pln | |
| Fluorochem | 500mg | 997.58 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
5-amino-2-chloro-N-(4-chlorophenyl)benzenesulfonamide (CAS 328028-10-0) is a chemical compound with the molecular formula C12H10Cl2N2O2S and a molecular weight of 317.2 g/mol. IUPAC name: 5-amino-2-chloro-N-(4-chlorophenyl)benzenesulfonamide. InChIKey: YVKDNDJJRCHLJY-UHFFFAOYSA-N.
| Molecular formula | C12H10Cl2N2O2S |
|---|---|
| Molecular weight | 317.2 g/mol |
| IUPAC name | 5-amino-2-chloro-N-(4-chlorophenyl)benzenesulfonamide |
| InChIKey | YVKDNDJJRCHLJY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NS(=O)(=O)C2=C(C=CC(=C2)N)Cl)Cl |
Computed by PubChem (NCBI)