CAS 34392-63-7 is the registry number for 4-Amino-n-(3,4-dichlorophenyl)benzenesulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
4-amino-N-(3,4-dichlorophenyl)benzenesulfonamide (CAS 34392-63-7) is a chemical compound with the molecular formula C12H10Cl2N2O2S and a molecular weight of 317.2 g/mol. IUPAC name: 4-amino-N-(3,4-dichlorophenyl)benzenesulfonamide. InChIKey: CDCMAMVXGZBIAX-UHFFFAOYSA-N.
| Molecular formula | C12H10Cl2N2O2S |
|---|---|
| Molecular weight | 317.2 g/mol |
| IUPAC name | 4-amino-N-(3,4-dichlorophenyl)benzenesulfonamide |
| InChIKey | CDCMAMVXGZBIAX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)S(=O)(=O)NC2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)