Products 325724-65-0
CAS 325724-65-0 is the registry number for 5-Amino-2-chloro-n-(3-chloro-phenyl)-benzenesulfonamide, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
5-amino-2-chloro-N-(3-chlorophenyl)benzenesulfonamide (CAS 325724-65-0) is a chemical compound with the molecular formula C12H10Cl2N2O2S and a molecular weight of 317.2 g/mol. IUPAC name: 5-amino-2-chloro-N-(3-chlorophenyl)benzenesulfonamide. InChIKey: NEACNGHHQWFDRG-UHFFFAOYSA-N.
| Molecular formula | C12H10Cl2N2O2S |
|---|---|
| Molecular weight | 317.2 g/mol |
| IUPAC name | 5-amino-2-chloro-N-(3-chlorophenyl)benzenesulfonamide |
| InChIKey | NEACNGHHQWFDRG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)NS(=O)(=O)C2=C(C=CC(=C2)N)Cl |
Computed by PubChem (NCBI)