CAS 439118-59-9 appears in our catalog under these names: 4-Amino-N-(2,4-dichlorophenyl)benzene-1-sulfonamide, 95%, 4-Amino-N-(2,4-dichlorophenyl)benzene-1-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
4-amino-N-(2,4-dichlorophenyl)benzenesulfonamide (CAS 439118-59-9) is a chemical compound with the molecular formula C12H10Cl2N2O2S and a molecular weight of 317.2 g/mol. IUPAC name: 4-amino-N-(2,4-dichlorophenyl)benzenesulfonamide. InChIKey: GXTOSZWQJYNQQP-UHFFFAOYSA-N.
| Molecular formula | C12H10Cl2N2O2S |
|---|---|
| Molecular weight | 317.2 g/mol |
| IUPAC name | 4-amino-N-(2,4-dichlorophenyl)benzenesulfonamide |
| InChIKey | GXTOSZWQJYNQQP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)S(=O)(=O)NC2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)