cas: 17467-15-1 — see every product listed under this CAS number, including other names
5-Amino-3-phenyl-1,2,4-thiadiazole, 98% (CAS 17467-15-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F009735-1G |
| cas | 17467-15-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 138.51 Pln | |
| Fluorochem | 5g | 289.50 Pln | |
| Fluorochem | 25g | 747.67 Pln | |
| Fluorochem | 100g | 2788.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
3-phenyl-1,2,4-thiadiazol-5-amine (CAS 17467-15-1) is a chemical compound with the molecular formula C8H7N3S and a molecular weight of 177.23 g/mol. IUPAC name: 3-phenyl-1,2,4-thiadiazol-5-amine. InChIKey: OYAHSBDYBOBAAQ-UHFFFAOYSA-N.
| Molecular formula | C8H7N3S |
|---|---|
| Molecular weight | 177.23 g/mol |
| IUPAC name | 3-phenyl-1,2,4-thiadiazol-5-amine |
| InChIKey | OYAHSBDYBOBAAQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NSC(=N2)N |
Computed by PubChem (NCBI)