cas: 24786-52-5 — see every product listed under this CAS number, including other names
5-Amino-6-Bromo-1,3-Dimethyl-1H-Benzo[D]Imidazol-2(3H)-One, 98%, 98% (CAS 24786-52-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113PFB-100mg |
| cas | 24786-52-5 |
| size | 100mg |
| availability | 7g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 290.00 Pln | |
| Chemat | 250mg | 438.80 Pln | |
| Chemat | 1g | 818.00 Pln | |
| Chemat | 5g | 2517.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
5-amino-6-bromo-1,3-dimethylbenzimidazol-2-one (CAS 24786-52-5) is a chemical compound with the molecular formula C9H10BrN3O and a molecular weight of 256.10 g/mol. IUPAC name: 5-amino-6-bromo-1,3-dimethylbenzimidazol-2-one. InChIKey: SXPRALARBJCCIH-UHFFFAOYSA-N.
| Molecular formula | C9H10BrN3O |
|---|---|
| Molecular weight | 256.10 g/mol |
| IUPAC name | 5-amino-6-bromo-1,3-dimethylbenzimidazol-2-one |
| InChIKey | SXPRALARBJCCIH-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=C(C(=C2)N)Br)N(C1=O)C |
Computed by PubChem (NCBI)