CAS 2691125-49-0 is the registry number for 2-Bromo-4-methoxy-3,6-dimethylpyrazolo[1,5-a]pyrazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-4-methoxy-3,6-dimethylpyrazolo[1,5-a]pyrazine (CAS 2691125-49-0) is a chemical compound with the molecular formula C9H10BrN3O and a molecular weight of 256.10 g/mol. IUPAC name: 2-bromo-4-methoxy-3,6-dimethylpyrazolo[1,5-a]pyrazine. InChIKey: MWNFRGAGEVJYTE-UHFFFAOYSA-N.
| Molecular formula | C9H10BrN3O |
|---|---|
| Molecular weight | 256.10 g/mol |
| IUPAC name | 2-bromo-4-methoxy-3,6-dimethylpyrazolo[1,5-a]pyrazine |
| InChIKey | MWNFRGAGEVJYTE-UHFFFAOYSA-N |
| SMILES | CC1=CN2C(=C(C(=N2)Br)C)C(=N1)OC |
Computed by PubChem (NCBI)