Products 914347-64-1
CAS 914347-64-1 is the registry number for 1-(5-Bromopyrimidin-2-yl)-4-piperidinone, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g, 250mg.
1-(5-bromopyrimidin-2-yl)piperidin-4-one (CAS 914347-64-1) is a chemical compound with the molecular formula C9H10BrN3O and a molecular weight of 256.10 g/mol. IUPAC name: 1-(5-bromopyrimidin-2-yl)piperidin-4-one. InChIKey: YMCZXCIBGNKAQX-UHFFFAOYSA-N.
| Molecular formula | C9H10BrN3O |
|---|---|
| Molecular weight | 256.10 g/mol |
| IUPAC name | 1-(5-bromopyrimidin-2-yl)piperidin-4-one |
| InChIKey | YMCZXCIBGNKAQX-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1=O)C2=NC=C(C=N2)Br |
Computed by PubChem (NCBI)