CAS 1429309-31-8 is the registry number for 3-Bromo-7-methoxy-5,6-dimethylpyrazolo[1,5-a]pyrimidine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-bromo-7-methoxy-5,6-dimethylpyrazolo[1,5-a]pyrimidine (CAS 1429309-31-8) is a chemical compound with the molecular formula C9H10BrN3O and a molecular weight of 256.10 g/mol. IUPAC name: 3-bromo-7-methoxy-5,6-dimethylpyrazolo[1,5-a]pyrimidine. InChIKey: SUDUNBAFWQUDHF-UHFFFAOYSA-N.
| Molecular formula | C9H10BrN3O |
|---|---|
| Molecular weight | 256.10 g/mol |
| IUPAC name | 3-bromo-7-methoxy-5,6-dimethylpyrazolo[1,5-a]pyrimidine |
| InChIKey | SUDUNBAFWQUDHF-UHFFFAOYSA-N |
| SMILES | CC1=C(N2C(=C(C=N2)Br)N=C1C)OC |
Computed by PubChem (NCBI)