cas: 1352395-15-3 — see every product listed under this CAS number, including other names
5-Aminopyrazolo(1,5-a)pyridine-3-carboxylic acid, 95+% (CAS 1352395-15-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A700055-5g |
| cas | 1352395-15-3 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 26643.82 Pln | |
| AmBeed | 10g | 39846.10 Pln | |
| AmBeed | 1g | 10648.75 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-aminopyrazolo[1,5-a]pyridine-3-carboxylic acid (CAS 1352395-15-3) is a chemical compound with the molecular formula C8H7N3O2 and a molecular weight of 177.16 g/mol. IUPAC name: 5-aminopyrazolo[1,5-a]pyridine-3-carboxylic acid. InChIKey: HDFMKHWLGQHWEF-UHFFFAOYSA-N.
| Molecular formula | C8H7N3O2 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 5-aminopyrazolo[1,5-a]pyridine-3-carboxylic acid |
| InChIKey | HDFMKHWLGQHWEF-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=C(C=N2)C(=O)O)C=C1N |
Computed by PubChem (NCBI)