cas: 1073354-99-0 — see every product listed under this CAS number, including other names
5-Aminopyridine-3-boronic acid pinacol ester, 97% (CAS 1073354-99-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F092850-1G |
| cas | 1073354-99-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 169.75 Pln | |
| Fluorochem | 5g | 383.22 Pln | |
| Fluorochem | 10g | 700.81 Pln | |
| Fluorochem | 25g | 1669.22 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-amine (CAS 1073354-99-0) is a chemical compound with the molecular formula C11H17BN2O2 and a molecular weight of 220.08 g/mol. IUPAC name: 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-amine. InChIKey: DAISWHFZWZZBBD-UHFFFAOYSA-N.
| Molecular formula | C11H17BN2O2 |
|---|---|
| Molecular weight | 220.08 g/mol |
| IUPAC name | 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-3-amine |
| InChIKey | DAISWHFZWZZBBD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2)N |
Computed by PubChem (NCBI)